C11H11Cl3N4O3 — CID 28526793
2,2,2-trichloro-1-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 28526793) has the molecular formula C11H11Cl3N4O3 and a molecular weight of 353.59 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 28526793 |
| Molecular Formula | C11H11Cl3N4O3 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2ccc([N+](=O)[O-])nc2)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3N4O3/c12-11(13,14)10(19)17-5-3-16(4-6-17)8-1-2-9(15-7-8)18(20)21/h1-2,7H,3-6H2 |
| InChIKey | IADAJGQCUAJORU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|