C17H19F2N5O4 — CID 154846936
1-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-2-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 154846936) has the molecular formula C17H19F2N5O4 and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-2-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-2-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 154846936 |
| Molecular Formula | C17H19F2N5O4 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-2-[4-(6-nitro-3-pyridinyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CC2CC(F)(F)C2C1)N1CCN(c2ccc([N+](=O)[O-])nc2)CC1 |
| InChI | InChI=1S/C17H19F2N5O4/c18-17(19)7-11-9-23(10-13(11)17)16(26)15(25)22-5-3-21(4-6-22)12-1-2-14(20-8-12)24(27)28/h1-2,8,11,13H,3-7,9-10H2 |
| InChIKey | HBDYCLRNBGCVOQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|