C13H16Cl2N4O2 — CID 34554737
1-[[(1R)-2,2-dichlorocyclopropyl]methyl]-4-(6-nitro-3-pyridinyl)piperazine (PubChem CID 34554737) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-[[(1R)-2,2-dichlorocyclopropyl]methyl]-4-(6-nitro-3-pyridinyl)piperazine.
| Compound Name | 1-[[(1R)-2,2-dichlorocyclopropyl]methyl]-4-(6-nitro-3-pyridinyl)piperazine |
|---|---|
| PubChem CID | 34554737 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-[[(1R)-2,2-dichlorocyclopropyl]methyl]-4-(6-nitro-3-pyridinyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(C[C@H]3CC3(Cl)Cl)CC2)cn1 |
| InChI | InChI=1S/C13H16Cl2N4O2/c14-13(15)7-10(13)9-17-3-5-18(6-4-17)11-1-2-12(16-8-11)19(20)21/h1-2,8,10H,3-7,9H2/t10-/m1/s1 |
| InChIKey | OCTWNYINQDKJGE-SNVBAGLBSA-N |
| XLogP | 2.31 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|