C20H28N6O4 — CID 47045156
[4-(6-nitro-3-pyridinyl)piperazin-1-yl]-[1-(pyrrolidine-1-carbonyl)piperidin-3-yl]methanone (PubChem CID 47045156) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [4-(6-nitro-3-pyridinyl)piperazin-1-yl]-[1-(pyrrolidine-1-carbonyl)piperidin-3-yl]methanone.
| Compound Name | [4-(6-nitro-3-pyridinyl)piperazin-1-yl]-[1-(pyrrolidine-1-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 47045156 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [4-(6-nitro-3-pyridinyl)piperazin-1-yl]-[1-(pyrrolidine-1-carbonyl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(C(=O)N2CCCC2)C1)N1CCN(c2ccc([N+](=O)[O-])nc2)CC1 |
| InChI | InChI=1S/C20H28N6O4/c27-19(16-4-3-9-25(15-16)20(28)24-7-1-2-8-24)23-12-10-22(11-13-23)17-5-6-18(21-14-17)26(29)30/h5-6,14,16H,1-4,7-13,15H2 |
| InChIKey | CXSLTDJMBVNDJG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|