C18H22O2 — CID 162642036
4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol (PubChem CID 162642036) has the molecular formula C18H22O2 and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol.
| Compound Name | 4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
|---|---|
| PubChem CID | 162642036 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[2,2,3,4,5,5-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| SMILES | [2H]C([2H])(C)C([2H])(c1ccc(O)cc1)C([2H])(c1ccc(O)cc1)C([2H])([2H])C |
| InChI | InChI=1S/C18H22O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-20H,3-4H2,1-2H3/i3D2,4D2,17D,18D |
| InChIKey | PBBGSZCBWVPOOL-WQNCLESNSA-N |
| XLogP | 4.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |