C18H19N7O — CID 162644547
1-[3-[4-[(4-cyclopropyltriazol-1-yl)methyl]phenyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboximidamide (PubChem CID 162644547) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-[3-[4-[(4-cyclopropyltriazol-1-yl)methyl]phenyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboximidamide.
| Compound Name | 1-[3-[4-[(4-cyclopropyltriazol-1-yl)methyl]phenyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 162644547 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[3-[4-[(4-cyclopropyltriazol-1-yl)methyl]phenyl]-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1(c2nc(-c3ccc(Cn4cc(C5CC5)nn4)cc3)no2)CC1 |
| InChI | InChI=1S/C18H19N7O/c19-16(20)18(7-8-18)17-21-15(23-26-17)13-3-1-11(2-4-13)9-25-10-14(22-24-25)12-5-6-12/h1-4,10,12H,5-9H2,(H3,19,20) |
| InChIKey | LGXKDGUAIRZOEV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|