C22H25N9O — CID 175618187
1-[2-[[3-[4-[[4-(1-methylpyrazol-4-yl)triazol-1-yl]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]pyrrolidin-1-yl]ethanimine (PubChem CID 175618187) has the molecular formula C22H25N9O and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[2-[[3-[4-[[4-(1-methylpyrazol-4-yl)triazol-1-yl]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]pyrrolidin-1-yl]ethanimine.
| Compound Name | 1-[2-[[3-[4-[[4-(1-methylpyrazol-4-yl)triazol-1-yl]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]pyrrolidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 175618187 |
| Molecular Formula | C22H25N9O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-[2-[[3-[4-[[4-(1-methylpyrazol-4-yl)triazol-1-yl]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]pyrrolidin-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)N1CCCC1Cc1nc(-c2ccc(Cn3cc(-c4cnn(C)c4)nn3)cc2)no1 |
| InChI | InChI=1S/C22H25N9O/c1-15(23)31-9-3-4-19(31)10-21-25-22(27-32-21)17-7-5-16(6-8-17)12-30-14-20(26-28-30)18-11-24-29(2)13-18/h5-8,11,13-14,19,23H,3-4,9-10,12H2,1-2H3/b23-15+ |
| InChIKey | DRCDHHQNRTUIPV-HZHRSRAPSA-N |
| XLogP | 2.78 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|