C35H37N7O7 — CID 162644926
N-(2-aminophenyl)-4-[7-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]heptanoylamino]benzamide (PubChem CID 162644926) has the molecular formula C35H37N7O7 and a molecular weight of 667.72 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[7-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]heptanoylamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[7-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]heptanoylamino]benzamide |
|---|---|
| PubChem CID | 162644926 |
| Molecular Formula | C35H37N7O7 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | N-(2-aminophenyl)-4-[7-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]heptanoylamino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)CCCCCCNC(=O)CNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C35H37N7O7/c36-24-9-4-5-10-25(24)40-32(46)21-13-15-22(16-14-21)39-28(43)12-3-1-2-6-19-37-30(45)20-38-26-11-7-8-23-31(26)35(49)42(34(23)48)27-17-18-29(44)41-33(27)47/h4-5,7-11,13-16,27,38H,1-3,6,12,17-20,36H2,(H,37,45)(H,39,43)(H,40,46)(H,41,44,47) |
| InChIKey | WXWAPGNHECFJAW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|