C21H16FN3O3S — CID 162647027
6-acetamido-4-(4-fluoro-3-thiophen-3-ylanilino)-1H-indole-2-carboxylic acid (PubChem CID 162647027) has the molecular formula C21H16FN3O3S and a molecular weight of 409.44 g/mol. Its IUPAC name is 6-acetamido-4-(4-fluoro-3-thiophen-3-ylanilino)-1H-indole-2-carboxylic acid.
| Compound Name | 6-acetamido-4-(4-fluoro-3-thiophen-3-ylanilino)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 162647027 |
| Molecular Formula | C21H16FN3O3S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 6-acetamido-4-(4-fluoro-3-thiophen-3-ylanilino)-1H-indole-2-carboxylic acid |
| SMILES | CC(=O)Nc1cc(Nc2ccc(F)c(-c3ccsc3)c2)c2cc(C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C21H16FN3O3S/c1-11(26)23-14-7-18(16-9-20(21(27)28)25-19(16)8-14)24-13-2-3-17(22)15(6-13)12-4-5-29-10-12/h2-10,24-25H,1H3,(H,23,26)(H,27,28) |
| InChIKey | JBUPALPCHYXVLO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |