C16H14N6O5 — CID 162647418
(2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 162647418) has the molecular formula C16H14N6O5 and a molecular weight of 370.33 g/mol. Its IUPAC name is (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 162647418 |
| Molecular Formula | C16H14N6O5 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2R)-2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | Nc1nc2nc(C(=O)N[C@H](Cc3ccc(O)cc3)C(=O)O)cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N6O5/c17-16-21-12-11(14(25)22-16)18-6-10(19-12)13(24)20-9(15(26)27)5-7-1-3-8(23)4-2-7/h1-4,6,9,23H,5H2,(H,20,24)(H,26,27)(H3,17,19,21,22,25)/t9-/m1/s1 |
| InChIKey | BYYDVPCOJAQWPZ-SECBINFHSA-N |
| XLogP | -0.57 |
| TPSA | 184.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |