C32H25N7O — CID 162647970
N-[(E)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide (PubChem CID 162647970) has the molecular formula C32H25N7O and a molecular weight of 523.60 g/mol. Its IUPAC name is N-[(E)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide.
| Compound Name | N-[(E)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide |
|---|---|
| PubChem CID | 162647970 |
| Molecular Formula | C32H25N7O |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[(E)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-phenyltriazol-1-yl)benzamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2cccc(-n3cc(-c4ccccc4)nn3)c2)cc1 |
| InChI | InChI=1S/C32H25N7O/c1-23-15-17-25(18-16-23)31-27(21-38(36-31)28-12-6-3-7-13-28)20-33-35-32(40)26-11-8-14-29(19-26)39-22-30(34-37-39)24-9-4-2-5-10-24/h2-22H,1H3,(H,35,40)/b33-20+ |
| InChIKey | ZYQBWFZYJGKGGA-FMFFXOCNSA-N |
| XLogP | 5.86 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|