C12H20O7 — CID 162648113
[(E)-4-hydroxy-2-methoxycarbonylbut-2-enyl] (2R,3R)-2-ethyl-2,3-dihydroxybutanoate (PubChem CID 162648113) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(E)-4-hydroxy-2-methoxycarbonylbut-2-enyl] (2R,3R)-2-ethyl-2,3-dihydroxybutanoate.
| Compound Name | [(E)-4-hydroxy-2-methoxycarbonylbut-2-enyl] (2R,3R)-2-ethyl-2,3-dihydroxybutanoate |
|---|---|
| PubChem CID | 162648113 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [(E)-4-hydroxy-2-methoxycarbonylbut-2-enyl] (2R,3R)-2-ethyl-2,3-dihydroxybutanoate |
| SMILES | CC[C@](O)(C(=O)OC/C(=C\CO)C(=O)OC)[C@@H](C)O |
| InChI | InChI=1S/C12H20O7/c1-4-12(17,8(2)14)11(16)19-7-9(5-6-13)10(15)18-3/h5,8,13-14,17H,4,6-7H2,1-3H3/b9-5+/t8-,12-/m1/s1 |
| InChIKey | QFBAQFWJRPENHZ-ZOUJZVOPSA-N |
| XLogP | -0.86 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|