C13H22O5 — CID 141260257
3-methylbut-2-enoyl 2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentanoate (PubChem CID 141260257) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-methylbut-2-enoyl 2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentanoate.
| Compound Name | 3-methylbut-2-enoyl 2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 141260257 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-methylbut-2-enoyl 2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentanoate |
| SMILES | CC(C)=CC(=O)OC(=O)C(O)(CO)CC(C)(C)C |
| InChI | InChI=1S/C13H22O5/c1-9(2)6-10(15)18-11(16)13(17,8-14)7-12(3,4)5/h6,14,17H,7-8H2,1-5H3 |
| InChIKey | LCZGNCFMMVYBBR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|