C14H26O6 — CID 158072511
methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate (PubChem CID 158072511) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate.
| Compound Name | methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 158072511 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate |
| SMILES | CC/C=C(\C)C(=O)OC.CC[C@@H](O)[C@](C)(O)C(=O)OC |
| InChI | InChI=1S/C7H14O4.C7H12O2/c1-4-5(8)7(2,10)6(9)11-3;1-4-5-6(2)7(8)9-3/h5,8,10H,4H2,1-3H3;5H,4H2,1-3H3/b;6-5+/t5-,7+;/m1./s1 |
| InChIKey | FLZHUPYYUNBMQY-IJBOBKMKSA-N |
| XLogP | 1.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|