C21H40O7 — CID 158321310
2,2-dimethylpentan-3-one;methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate (PubChem CID 158321310) has the molecular formula C21H40O7 and a molecular weight of 404.54 g/mol. Its IUPAC name is 2,2-dimethylpentan-3-one;methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate.
| Compound Name | 2,2-dimethylpentan-3-one;methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 158321310 |
| Molecular Formula | C21H40O7 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2,2-dimethylpentan-3-one;methyl (2S,3R)-2,3-dihydroxy-2-methylpentanoate;methyl (E)-2-methylpent-2-enoate |
| SMILES | CC/C=C(\C)C(=O)OC.CCC(=O)C(C)(C)C.CC[C@@H](O)[C@](C)(O)C(=O)OC |
| InChI | InChI=1S/C7H14O4.C7H12O2.C7H14O/c1-4-5(8)7(2,10)6(9)11-3;1-4-5-6(2)7(8)9-3;1-5-6(8)7(2,3)4/h5,8,10H,4H2,1-3H3;5H,4H2,1-3H3;5H2,1-4H3/b;6-5+;/t5-,7+;;/m1../s1 |
| InChIKey | GOWPSROFRLOUCV-HLMSFSLZSA-N |
| XLogP | 3.21 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|