C15H28O5 — CID 162151555
methane;methyl 3-ethyl-2-methyloxirane-2-carboxylate;methyl (E)-2-methylpent-2-enoate (PubChem CID 162151555) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is methane;methyl 3-ethyl-2-methyloxirane-2-carboxylate;methyl (E)-2-methylpent-2-enoate.
| Compound Name | methane;methyl 3-ethyl-2-methyloxirane-2-carboxylate;methyl (E)-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 162151555 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | methane;methyl 3-ethyl-2-methyloxirane-2-carboxylate;methyl (E)-2-methylpent-2-enoate |
| SMILES | C.CC/C=C(\C)C(=O)OC.CCC1OC1(C)C(=O)OC |
| InChI | InChI=1S/C7H12O3.C7H12O2.CH4/c1-4-5-7(2,10-5)6(8)9-3;1-4-5-6(2)7(8)9-3;/h5H,4H2,1-3H3;5H,4H2,1-3H3;1H4/b;6-5+; |
| InChIKey | ZLGWACDBCNVBRZ-AUNBPGBOSA-N |
| XLogP | 2.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|