C15H26O5 — CID 173197441
2-hydroxyethyl 5,5-dimethyl-3-(2-methylbut-2-enoyloxy)hexanoate (PubChem CID 173197441) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-hydroxyethyl 5,5-dimethyl-3-(2-methylbut-2-enoyloxy)hexanoate.
| Compound Name | 2-hydroxyethyl 5,5-dimethyl-3-(2-methylbut-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 173197441 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-hydroxyethyl 5,5-dimethyl-3-(2-methylbut-2-enoyloxy)hexanoate |
| SMILES | CC=C(C)C(=O)OC(CC(=O)OCCO)CC(C)(C)C |
| InChI | InChI=1S/C15H26O5/c1-6-11(2)14(18)20-12(10-15(3,4)5)9-13(17)19-8-7-16/h6,12,16H,7-10H2,1-5H3 |
| InChIKey | JQYLJEAHUDBNBJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|