C19H14N6O2S2 — CID 162648351
3-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 162648351) has the molecular formula C19H14N6O2S2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 162648351 |
| Molecular Formula | C19H14N6O2S2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-4-[(Z)-(4-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc(-c2ccccc2)sc1-c1n[nH]c(=S)n1/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N6O2S2/c1-12-16(29-18(21-12)14-5-3-2-4-6-14)17-22-23-19(28)24(17)20-11-13-7-9-15(10-8-13)25(26)27/h2-11H,1H3,(H,23,28)/b20-11- |
| InChIKey | XZGMAAFMIJJKTK-JAIQZWGSSA-N |
| XLogP | 4.83 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|