C29H29Cl2N3O2 — CID 162650508
(Z)-2-(3,4-dichlorophenyl)-3-[4-[2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]phenyl]prop-2-enenitrile (PubChem CID 162650508) has the molecular formula C29H29Cl2N3O2 and a molecular weight of 522.48 g/mol. Its IUPAC name is (Z)-2-(3,4-dichlorophenyl)-3-[4-[2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dichlorophenyl)-3-[4-[2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162650508 |
| Molecular Formula | C29H29Cl2N3O2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (Z)-2-(3,4-dichlorophenyl)-3-[4-[2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]phenyl]prop-2-enenitrile |
| SMILES | Cc1ccc(N2CCN(CC(O)COc3ccc(/C=C(\C#N)c4ccc(Cl)c(Cl)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29Cl2N3O2/c1-21-2-7-25(8-3-21)34-14-12-33(13-15-34)19-26(35)20-36-27-9-4-22(5-10-27)16-24(18-32)23-6-11-28(30)29(31)17-23/h2-11,16-17,26,35H,12-15,19-20H2,1H3/b24-16+ |
| InChIKey | IUBFDLIWHRDKAL-LFVJCYFKSA-N |
| XLogP | 5.93 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|