C26H23N3O5 — CID 162650773
4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(3-methylphenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one (PubChem CID 162650773) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(3-methylphenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(3-methylphenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 162650773 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(3-methylphenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one |
| SMILES | Cc1cccc(Cn2cc(COc3ccc(/C=C/C(=O)c4c(O)cc(C)oc4=O)cc3)nn2)c1 |
| InChI | InChI=1S/C26H23N3O5/c1-17-4-3-5-20(12-17)14-29-15-21(27-28-29)16-33-22-9-6-19(7-10-22)8-11-23(30)25-24(31)13-18(2)34-26(25)32/h3-13,15,31H,14,16H2,1-2H3/b11-8+ |
| InChIKey | SFDJQWSQSMQOQV-DHZHZOJOSA-N |
| XLogP | 4.08 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|