C19H23ClN4O3 — CID 162651124
5-(1-benzyl-5-nitroindazol-3-yl)oxypentan-1-amine;hydrochloride (PubChem CID 162651124) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-(1-benzyl-5-nitroindazol-3-yl)oxypentan-1-amine;hydrochloride.
| Compound Name | 5-(1-benzyl-5-nitroindazol-3-yl)oxypentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 162651124 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 5-(1-benzyl-5-nitroindazol-3-yl)oxypentan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCCOc1nn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C19H22N4O3.ClH/c20-11-5-2-6-12-26-19-17-13-16(23(24)25)9-10-18(17)22(21-19)14-15-7-3-1-4-8-15;/h1,3-4,7-10,13H,2,5-6,11-12,14,20H2;1H |
| InChIKey | OHCFVQJSMFKBJA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|