C18H15NO5 — CID 162652059
2-[7-[(E)-2-(4-methoxyphenyl)ethenyl]-2-oxo-1,3-benzoxazol-3-yl]acetic acid (PubChem CID 162652059) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[7-[(E)-2-(4-methoxyphenyl)ethenyl]-2-oxo-1,3-benzoxazol-3-yl]acetic acid.
| Compound Name | 2-[7-[(E)-2-(4-methoxyphenyl)ethenyl]-2-oxo-1,3-benzoxazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 162652059 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[7-[(E)-2-(4-methoxyphenyl)ethenyl]-2-oxo-1,3-benzoxazol-3-yl]acetic acid |
| SMILES | COc1ccc(/C=C/c2cccc3c2oc(=O)n3CC(=O)O)cc1 |
| InChI | InChI=1S/C18H15NO5/c1-23-14-9-6-12(7-10-14)5-8-13-3-2-4-15-17(13)24-18(22)19(15)11-16(20)21/h2-10H,11H2,1H3,(H,20,21)/b8-5+ |
| InChIKey | VKMXKQKSPAFXQV-VMPITWQZSA-N |
| XLogP | 2.86 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|