C23H32ClN3O8S — CID 162654158
(2S)-2-[[(2S)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid (PubChem CID 162654158) has the molecular formula C23H32ClN3O8S and a molecular weight of 546.04 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 162654158 |
| Molecular Formula | C23H32ClN3O8S |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(E)-3-(3-chlorophenyl)prop-2-enoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC/C=C/c1cccc(Cl)c1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C23H32ClN3O8S/c1-14(2)11-18(27-23(31)35-10-4-6-15-5-3-7-17(24)12-15)21(29)26-19(22(30)36(32,33)34)13-16-8-9-25-20(16)28/h3-7,12,14,16,18-19,22,30H,8-11,13H2,1-2H3,(H,25,28)(H,26,29)(H,27,31)(H,32,33,34)/b6-4+/t16-,18-,19-,22?/m0/s1 |
| InChIKey | HMQNNKCRWJILIE-VYJWVURTSA-N |
| XLogP | 1.71 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|