C23H41N3O8S — CID 166771777
2-[[2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid (PubChem CID 166771777) has the molecular formula C23H41N3O8S and a molecular weight of 519.66 g/mol. Its IUPAC name is 2-[[2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid.
| Compound Name | 2-[[2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166771777 |
| Molecular Formula | C23H41N3O8S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-[[2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonic acid |
| SMILES | CC(C)CC(NC(=O)OCCCC1CCCCC1)C(=O)NC(C[C@@H]1CCNC1=O)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C23H41N3O8S/c1-15(2)13-18(26-23(30)34-12-6-9-16-7-4-3-5-8-16)21(28)25-19(22(29)35(31,32)33)14-17-10-11-24-20(17)27/h15-19,22,29H,3-14H2,1-2H3,(H,24,27)(H,25,28)(H,26,30)(H,31,32,33)/t17-,18?,19?,22?/m0/s1 |
| InChIKey | SJYJYMIWXGRKBT-OLYSNNBPSA-N |
| XLogP | 1.71 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|