C24H33N7O — CID 162655779
8-cyclopentyl-5-ethyl-2-[[5-(4-methylpiperidin-1-yl)-2-pyridinyl]amino]-7H-pteridin-6-one (PubChem CID 162655779) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 8-cyclopentyl-5-ethyl-2-[[5-(4-methylpiperidin-1-yl)-2-pyridinyl]amino]-7H-pteridin-6-one.
| Compound Name | 8-cyclopentyl-5-ethyl-2-[[5-(4-methylpiperidin-1-yl)-2-pyridinyl]amino]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 162655779 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 8-cyclopentyl-5-ethyl-2-[[5-(4-methylpiperidin-1-yl)-2-pyridinyl]amino]-7H-pteridin-6-one |
| SMILES | CCN1C(=O)CN(C2CCCC2)c2nc(Nc3ccc(N4CCC(C)CC4)cn3)ncc21 |
| InChI | InChI=1S/C24H33N7O/c1-3-30-20-15-26-24(28-23(20)31(16-22(30)32)18-6-4-5-7-18)27-21-9-8-19(14-25-21)29-12-10-17(2)11-13-29/h8-9,14-15,17-18H,3-7,10-13,16H2,1-2H3,(H,25,26,27,28) |
| InChIKey | LXQSAVMYIWXVFQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |