C15H15F3N4O4 — CID 162655804
N-methyl-N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 162655804) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is N-methyl-N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-methyl-N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 162655804 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-methyl-N-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CN(CC1CCn2cc([N+](=O)[O-])nc2O1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N4O4/c1-20(10-2-4-11(5-3-10)26-15(16,17)18)8-12-6-7-21-9-13(22(23)24)19-14(21)25-12/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | HBUAPLGGWVKMHX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|