C18H18F3N5O6 — CID 50916528
[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] 4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate (PubChem CID 50916528) has the molecular formula C18H18F3N5O6 and a molecular weight of 457.37 g/mol. Its IUPAC name is [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] 4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate.
| Compound Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] 4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 50916528 |
| Molecular Formula | C18H18F3N5O6 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] 4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate |
| SMILES | O=C(O[C@@H]1COc2nc([N+](=O)[O-])cn2C1)N1CCN(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H18F3N5O6/c19-18(20,21)32-13-3-1-12(2-4-13)23-5-7-24(8-6-23)17(27)31-14-9-25-10-15(26(28)29)22-16(25)30-11-14/h1-4,10,14H,5-9,11H2/t14-/m0/s1 |
| InChIKey | KLZHZXNGDKJDJB-AWEZNQCLSA-N |
| XLogP | 2.41 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|