C33H33N7O7 — CID 162656750
N-(2-aminophenyl)-4-[5-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]pentanoylamino]benzamide (PubChem CID 162656750) has the molecular formula C33H33N7O7 and a molecular weight of 639.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[5-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]pentanoylamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[5-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]pentanoylamino]benzamide |
|---|---|
| PubChem CID | 162656750 |
| Molecular Formula | C33H33N7O7 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | N-(2-aminophenyl)-4-[5-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]pentanoylamino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)CCCCNC(=O)CNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C33H33N7O7/c34-22-7-1-2-8-23(22)38-30(44)19-11-13-20(14-12-19)37-26(41)10-3-4-17-35-28(43)18-36-24-9-5-6-21-29(24)33(47)40(32(21)46)25-15-16-27(42)39-31(25)45/h1-2,5-9,11-14,25,36H,3-4,10,15-18,34H2,(H,35,43)(H,37,41)(H,38,44)(H,39,42,45) |
| InChIKey | SRCGSXKCMDYLRX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|