C21H30N2O7 — CID 162657720
(2S,3R,4S,5S,6R)-2-[1,3-dimethyl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162657720) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[1,3-dimethyl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[1,3-dimethyl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162657720 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[1,3-dimethyl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1nn(C)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1Cc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O7/c1-11(2)28-14-7-5-13(6-8-14)9-15-12(3)22-23(4)20(15)30-21-19(27)18(26)17(25)16(10-24)29-21/h5-8,11,16-19,21,24-27H,9-10H2,1-4H3/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | LYKJSNAWYGXTNF-YRIDSSQKSA-N |
| XLogP | 0.29 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |