C19H26BrN3O3 — CID 162658091
2-[(4-bromophenyl)carbamoylamino]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 162658091) has the molecular formula C19H26BrN3O3 and a molecular weight of 424.34 g/mol. Its IUPAC name is 2-[(4-bromophenyl)carbamoylamino]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)carbamoylamino]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 162658091 |
| Molecular Formula | C19H26BrN3O3 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[(4-bromophenyl)carbamoylamino]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Nc1ccc(Br)cc1)NC(C(=O)NCC1CCCO1)C1CCCC1 |
| InChI | InChI=1S/C19H26BrN3O3/c20-14-7-9-15(10-8-14)22-19(25)23-17(13-4-1-2-5-13)18(24)21-12-16-6-3-11-26-16/h7-10,13,16-17H,1-6,11-12H2,(H,21,24)(H2,22,23,25) |
| InChIKey | JDGUPLBUZUNGHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |