C19H13N3O4 — CID 162658445
N-[2-(2-hydroxyphenyl)-4-oxoquinazolin-3-yl]furan-2-carboxamide (PubChem CID 162658445) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is N-[2-(2-hydroxyphenyl)-4-oxoquinazolin-3-yl]furan-2-carboxamide.
| Compound Name | N-[2-(2-hydroxyphenyl)-4-oxoquinazolin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 162658445 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[2-(2-hydroxyphenyl)-4-oxoquinazolin-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nn1c(-c2ccccc2O)nc2ccccc2c1=O)c1ccco1 |
| InChI | InChI=1S/C19H13N3O4/c23-15-9-4-2-7-13(15)17-20-14-8-3-1-6-12(14)19(25)22(17)21-18(24)16-10-5-11-26-16/h1-11,23H,(H,21,24) |
| InChIKey | LAUINQPWQTWINP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |