C16H9F3N4 — CID 162658639
5-[3-(trifluoromethyl)phenyl]-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 162658639) has the molecular formula C16H9F3N4 and a molecular weight of 314.27 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 162658639 |
| Molecular Formula | C16H9F3N4 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | FC(F)(F)c1cccc(-c2cnc3c4cccnc4nn3c2)c1 |
| InChI | InChI=1S/C16H9F3N4/c17-16(18,19)12-4-1-3-10(7-12)11-8-21-15-13-5-2-6-20-14(13)22-23(15)9-11/h1-9H |
| InChIKey | IKLWYGIHNWBZDN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |