C20H31N5O2 — CID 162658876
N-[4-oxo-5-(piperidin-1-ylmethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide (PubChem CID 162658876) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[4-oxo-5-(piperidin-1-ylmethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide.
| Compound Name | N-[4-oxo-5-(piperidin-1-ylmethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide |
|---|---|
| PubChem CID | 162658876 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | N-[4-oxo-5-(piperidin-1-ylmethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1nc2[nH]cc(CN3CCCCC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H31N5O2/c1-2-3-4-5-7-10-16(26)22-20-23-18-17(19(27)24-20)15(13-21-18)14-25-11-8-6-9-12-25/h13H,2-12,14H2,1H3,(H3,21,22,23,24,26,27) |
| InChIKey | YIYYOIORWXSIPA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|