C17H13N3O3 — CID 162659237
7-(2-hydroxyethylamino)indolo[2,1-b]quinazoline-6,12-dione (PubChem CID 162659237) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 7-(2-hydroxyethylamino)indolo[2,1-b]quinazoline-6,12-dione.
| Compound Name | 7-(2-hydroxyethylamino)indolo[2,1-b]quinazoline-6,12-dione |
|---|---|
| PubChem CID | 162659237 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 7-(2-hydroxyethylamino)indolo[2,1-b]quinazoline-6,12-dione |
| SMILES | O=C1c2c(NCCO)cccc2-n2c1nc1ccccc1c2=O |
| InChI | InChI=1S/C17H13N3O3/c21-9-8-18-12-6-3-7-13-14(12)15(22)16-19-11-5-2-1-4-10(11)17(23)20(13)16/h1-7,18,21H,8-9H2 |
| InChIKey | WCEKQBSYSRGMNO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |