C31H30N6O6 — CID 162660382
N-(2-aminophenyl)-4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]benzamide (PubChem CID 162660382) has the molecular formula C31H30N6O6 and a molecular weight of 582.62 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]benzamide |
|---|---|
| PubChem CID | 162660382 |
| Molecular Formula | C31H30N6O6 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]pentanoylamino]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)CCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C31H30N6O6/c32-21-7-1-2-8-22(21)35-28(40)18-11-13-19(14-12-18)34-25(38)10-3-4-17-33-23-9-5-6-20-27(23)31(43)37(30(20)42)24-15-16-26(39)36-29(24)41/h1-2,5-9,11-14,24,33H,3-4,10,15-17,32H2,(H,34,38)(H,35,40)(H,36,39,41) |
| InChIKey | CDVJLYDZKYPQJI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|