C16H25N3O8 — CID 162660400
2-[[2-[[(1S)-1-carboxy-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]ethyl]-methylamino]acetyl]amino]pentanoic acid (PubChem CID 162660400) has the molecular formula C16H25N3O8 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[[2-[[(1S)-1-carboxy-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]ethyl]-methylamino]acetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[[(1S)-1-carboxy-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]ethyl]-methylamino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 162660400 |
| Molecular Formula | C16H25N3O8 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[[2-[[(1S)-1-carboxy-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]ethyl]-methylamino]acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CN(C)[C@@H](CNC(=O)/C=C/C(=O)OC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H25N3O8/c1-4-5-10(15(23)24)18-13(21)9-19(2)11(16(25)26)8-17-12(20)6-7-14(22)27-3/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,17,20)(H,18,21)(H,23,24)(H,25,26)/b7-6+/t10?,11-/m0/s1 |
| InChIKey | BTBXXLPAKSORQD-QDCQEWKOSA-N |
| XLogP | -1.41 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|