C17H17NO2 — CID 162660577
2,2-dimethyl-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one (PubChem CID 162660577) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2,2-dimethyl-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one.
| Compound Name | 2,2-dimethyl-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 162660577 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2,2-dimethyl-8-(4-methylphenyl)-6H-pyrano[3,2-c]pyridin-5-one |
| SMILES | Cc1ccc(-c2c[nH]c(=O)c3c2OC(C)(C)C=C3)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-11-4-6-12(7-5-11)14-10-18-16(19)13-8-9-17(2,3)20-15(13)14/h4-10H,1-3H3,(H,18,19) |
| InChIKey | CCFGRNISVPYQCF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |