C25H20N4O7 — CID 162661203
4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(2-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one (PubChem CID 162661203) has the molecular formula C25H20N4O7 and a molecular weight of 488.46 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(2-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(2-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 162661203 |
| Molecular Formula | C25H20N4O7 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[(E)-3-[4-[[1-[(2-nitrophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]pyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2ccc(OCc3cn(Cc4ccccc4[N+](=O)[O-])nn3)cc2)c(=O)o1 |
| InChI | InChI=1S/C25H20N4O7/c1-16-12-23(31)24(25(32)36-16)22(30)11-8-17-6-9-20(10-7-17)35-15-19-14-28(27-26-19)13-18-4-2-3-5-21(18)29(33)34/h2-12,14,31H,13,15H2,1H3/b11-8+ |
| InChIKey | NJZCMETWJPKRSS-DHZHZOJOSA-N |
| XLogP | 3.68 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|