C16H16N2O2S — CID 162661549
1-(benzenesulfonyl)-N,N-dimethylindol-5-amine (PubChem CID 162661549) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N,N-dimethylindol-5-amine.
| Compound Name | 1-(benzenesulfonyl)-N,N-dimethylindol-5-amine |
|---|---|
| PubChem CID | 162661549 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(benzenesulfonyl)-N,N-dimethylindol-5-amine |
| SMILES | CN(C)c1ccc2c(ccn2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-17(2)14-8-9-16-13(12-14)10-11-18(16)21(19,20)15-6-4-3-5-7-15/h3-12H,1-2H3 |
| InChIKey | LDFGXPKEEJPITD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |