C21H24N2O4S2 — CID 124563441
1-(benzenesulfonyl)-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylindole (PubChem CID 124563441) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylindole.
| Compound Name | 1-(benzenesulfonyl)-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylindole |
|---|---|
| PubChem CID | 124563441 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-(benzenesulfonyl)-5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylindole |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc3c(ccn3S(=O)(=O)c3ccccc3)c2)C1 |
| InChI | InChI=1S/C21H24N2O4S2/c1-16-12-17(2)15-22(14-16)28(24,25)20-8-9-21-18(13-20)10-11-23(21)29(26,27)19-6-4-3-5-7-19/h3-11,13,16-17H,12,14-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | MXOXHPLCYXJQQR-IAGOWNOFSA-N |
| XLogP | 3.54 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |