C41H43ClN4O9S4 — CID 157257186
1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole;1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole-3-carbonyl chloride (PubChem CID 157257186) has the molecular formula C41H43ClN4O9S4 and a molecular weight of 899.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole;1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole-3-carbonyl chloride.
| Compound Name | 1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole;1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole-3-carbonyl chloride |
|---|---|
| PubChem CID | 157257186 |
| Molecular Formula | C41H43ClN4O9S4 |
| Molecular Weight | 899.54 g/mol |
| Exact Mass | 898.16 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole;1-(benzenesulfonyl)-5-(4-methylpiperidin-1-yl)sulfonylindole-3-carbonyl chloride |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)c(C(=O)Cl)cn3S(=O)(=O)c2ccccc2)CC1.CC1CCN(S(=O)(=O)c2ccc3c(ccn3S(=O)(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C21H21ClN2O5S2.C20H22N2O4S2/c1-15-9-11-23(12-10-15)30(26,27)17-7-8-20-18(13-17)19(21(22)25)14-24(20)31(28,29)16-5-3-2-4-6-16;1-16-9-12-21(13-10-16)27(23,24)19-7-8-20-17(15-19)11-14-22(20)28(25,26)18-5-3-2-4-6-18/h2-8,13-15H,9-12H2,1H3;2-8,11,14-16H,9-10,12-13H2,1H3 |
| InChIKey | AXAIOJSGDSZKBH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 169.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|