C27H17NO4 — CID 162661723
3-(carbazol-9-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione (PubChem CID 162661723) has the molecular formula C27H17NO4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 3-(carbazol-9-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 3-(carbazol-9-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 162661723 |
| Molecular Formula | C27H17NO4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-(carbazol-9-ylmethyl)-1,8-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(Cn3c4ccccc4c4ccccc43)cc21 |
| InChI | InChI=1S/C27H17NO4/c29-22-11-5-8-18-24(22)27(32)25-19(26(18)31)12-15(13-23(25)30)14-28-20-9-3-1-6-16(20)17-7-2-4-10-21(17)28/h1-13,29-30H,14H2 |
| InChIKey | IPMVQJHXIUPEEJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|