C24H28N4O4 — CID 162662452
3-[[6-ethoxy-7-(3-hydroxypropoxy)-1-methyl-4H-indeno[2,1-d]pyrazol-3-yl]amino]-N-methylbenzamide (PubChem CID 162662452) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[[6-ethoxy-7-(3-hydroxypropoxy)-1-methyl-4H-indeno[2,1-d]pyrazol-3-yl]amino]-N-methylbenzamide.
| Compound Name | 3-[[6-ethoxy-7-(3-hydroxypropoxy)-1-methyl-4H-indeno[2,1-d]pyrazol-3-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 162662452 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[[6-ethoxy-7-(3-hydroxypropoxy)-1-methyl-4H-indeno[2,1-d]pyrazol-3-yl]amino]-N-methylbenzamide |
| SMILES | CCOc1cc2c(cc1OCCCO)-c1c(c(Nc3cccc(C(=O)NC)c3)nn1C)C2 |
| InChI | InChI=1S/C24H28N4O4/c1-4-31-20-13-16-12-19-22(18(16)14-21(20)32-10-6-9-29)28(3)27-23(19)26-17-8-5-7-15(11-17)24(30)25-2/h5,7-8,11,13-14,29H,4,6,9-10,12H2,1-3H3,(H,25,30)(H,26,27) |
| InChIKey | UQUUHYVKLVPIDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|