C24H32FN5O3 — CID 162663519
2-(4-fluorophenyl)-5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-1H-imidazole-4-carboxamide (PubChem CID 162663519) has the molecular formula C24H32FN5O3 and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-1H-imidazole-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 162663519 |
| Molecular Formula | C24H32FN5O3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-1H-imidazole-4-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CN(C)C1)c1[nH]c(-c2ccc(F)cc2)nc1C(N)=O |
| InChI | InChI=1S/C24H32FN5O3/c1-3-18(31)7-5-4-6-8-19(27-24(33)16-13-30(2)14-16)20-21(22(26)32)29-23(28-20)15-9-11-17(25)12-10-15/h9-12,16,19H,3-8,13-14H2,1-2H3,(H2,26,32)(H,27,33)(H,28,29)/t19-/m0/s1 |
| InChIKey | QXMVYSCRIRLZNR-IBGZPJMESA-N |
| XLogP | 2.96 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|