C19H19N3O3 — CID 162664478
2-oxo-N-(4-phenylbutyl)-5-pyridin-2-yl-1,3-oxazole-3-carboxamide (PubChem CID 162664478) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-oxo-N-(4-phenylbutyl)-5-pyridin-2-yl-1,3-oxazole-3-carboxamide.
| Compound Name | 2-oxo-N-(4-phenylbutyl)-5-pyridin-2-yl-1,3-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162664478 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-oxo-N-(4-phenylbutyl)-5-pyridin-2-yl-1,3-oxazole-3-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)n1cc(-c2ccccn2)oc1=O |
| InChI | InChI=1S/C19H19N3O3/c23-18(21-13-6-4-10-15-8-2-1-3-9-15)22-14-17(25-19(22)24)16-11-5-7-12-20-16/h1-3,5,7-9,11-12,14H,4,6,10,13H2,(H,21,23) |
| InChIKey | POYBDNBCSGXISN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|