C27H22ClF9N2O3 — CID 162664940
1-[5,5-bis[4-(trifluoromethoxy)phenyl]pentyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 162664940) has the molecular formula C27H22ClF9N2O3 and a molecular weight of 628.92 g/mol. Its IUPAC name is 1-[5,5-bis[4-(trifluoromethoxy)phenyl]pentyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5,5-bis[4-(trifluoromethoxy)phenyl]pentyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162664940 |
| Molecular Formula | C27H22ClF9N2O3 |
| Molecular Weight | 628.92 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | 1-[5,5-bis[4-(trifluoromethoxy)phenyl]pentyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCCC(c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22ClF9N2O3/c28-23-13-8-18(15-22(23)25(29,30)31)39-24(40)38-14-2-1-3-21(16-4-9-19(10-5-16)41-26(32,33)34)17-6-11-20(12-7-17)42-27(35,36)37/h4-13,15,21H,1-3,14H2,(H2,38,39,40) |
| InChIKey | OVBMHIHGYHTLDN-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.92 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|