C14H22F3N3O2 — CID 162664964
N-(1-hydroxy-2-methylpropan-2-yl)-1-pentyl-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 162664964) has the molecular formula C14H22F3N3O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-1-pentyl-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-pentyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162664964 |
| Molecular Formula | C14H22F3N3O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-pentyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NC(C)(C)CO)cc1C(F)(F)F |
| InChI | InChI=1S/C14H22F3N3O2/c1-4-5-6-7-20-11(14(15,16)17)8-10(19-20)12(22)18-13(2,3)9-21/h8,21H,4-7,9H2,1-3H3,(H,18,22) |
| InChIKey | UCTWAZGVKXHMRK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|