C16H28FN3O2 — CID 162664184
5-tert-butyl-1-(4-fluorobutyl)-N-(1-hydroxy-2-methylpropan-2-yl)pyrazole-3-carboxamide (PubChem CID 162664184) has the molecular formula C16H28FN3O2 and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-tert-butyl-1-(4-fluorobutyl)-N-(1-hydroxy-2-methylpropan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-1-(4-fluorobutyl)-N-(1-hydroxy-2-methylpropan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162664184 |
| Molecular Formula | C16H28FN3O2 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 5-tert-butyl-1-(4-fluorobutyl)-N-(1-hydroxy-2-methylpropan-2-yl)pyrazole-3-carboxamide |
| SMILES | CC(C)(CO)NC(=O)c1cc(C(C)(C)C)n(CCCCF)n1 |
| InChI | InChI=1S/C16H28FN3O2/c1-15(2,3)13-10-12(14(22)18-16(4,5)11-21)19-20(13)9-7-6-8-17/h10,21H,6-9,11H2,1-5H3,(H,18,22) |
| InChIKey | HNBJFIVJTNRPQI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|