C20H35N3O3 — CID 162667765
methyl (2R)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3,3-dimethylbutanoate (PubChem CID 162667765) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is methyl (2R)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3,3-dimethylbutanoate.
| Compound Name | methyl (2R)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 162667765 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | methyl (2R)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3,3-dimethylbutanoate |
| SMILES | CCCCCn1nc(C(=O)N[C@@H](C(=O)OC)C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H35N3O3/c1-9-10-11-12-23-15(19(2,3)4)13-14(22-23)17(24)21-16(18(25)26-8)20(5,6)7/h13,16H,9-12H2,1-8H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | YFEMRXYRYCUZJF-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|