C19H33N3O3 — CID 162668127
methyl (2S)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3-methylbutanoate (PubChem CID 162668127) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl (2S)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 162668127 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | methyl (2S)-2-[(5-tert-butyl-1-pentylpyrazole-3-carbonyl)amino]-3-methylbutanoate |
| SMILES | CCCCCn1nc(C(=O)N[C@H](C(=O)OC)C(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C19H33N3O3/c1-8-9-10-11-22-15(19(4,5)6)12-14(21-22)17(23)20-16(13(2)3)18(24)25-7/h12-13,16H,8-11H2,1-7H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | GKSCNTBYTYTZDO-INIZCTEOSA-N |
| XLogP | 3.30 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|